C15H18ClN3O2 — CID 119321878
N-[1-(2-chlorophenyl)-5-oxopyrrolidin-3-yl]pyrrolidine-2-carboxamide (PubChem CID 119321878) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-5-oxopyrrolidin-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-[1-(2-chlorophenyl)-5-oxopyrrolidin-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119321878 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-[1-(2-chlorophenyl)-5-oxopyrrolidin-3-yl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CC(=O)N(c2ccccc2Cl)C1)C1CCCN1 |
| InChI | InChI=1S/C15H18ClN3O2/c16-11-4-1-2-6-13(11)19-9-10(8-14(19)20)18-15(21)12-5-3-7-17-12/h1-2,4,6,10,12,17H,3,5,7-9H2,(H,18,21) |
| InChIKey | NCLOZRMCIHJYQU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |