C16H22N2O — CID 107126391
N-piperidin-4-yl-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 107126391) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is N-piperidin-4-yl-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-piperidin-4-yl-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 107126391 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-piperidin-4-yl-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NC1CCNCC1)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H22N2O/c19-16(18-15-7-9-17-10-8-15)14-6-5-12-3-1-2-4-13(12)11-14/h1-4,14-15,17H,5-11H2,(H,18,19) |
| InChIKey | DMIKKLROSYIVTP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |