C17H22ClNO — CID 107127715
N-(2-chlorocyclohexyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 107127715) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-(2-chlorocyclohexyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 107127715 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-(2-chlorocyclohexyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NC1CCCCC1Cl)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H22ClNO/c18-15-7-3-4-8-16(15)19-17(20)14-10-9-12-5-1-2-6-13(12)11-14/h1-2,5-6,14-16H,3-4,7-11H2,(H,19,20) |
| InChIKey | DSMSNVSLMKHTIQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|