C25H36 — CID 59989769
(3aS)-1-[2-[[(3aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]methyl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 59989769) has the molecular formula C25H36 and a molecular weight of 336.56 g/mol. Its IUPAC name is (3aS)-1-[2-[[(3aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]methyl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | (3aS)-1-[2-[[(3aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]methyl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 59989769 |
| Molecular Formula | C25H36 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | (3aS)-1-[2-[[(3aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]methyl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | c1ccc(C2CC[C@@H]3CCCCC23)c(CC2CC[C@@H]3CCCCC23)c1 |
| InChI | InChI=1S/C25H36/c1-4-10-22-18(7-1)13-14-21(22)17-20-9-3-6-12-24(20)25-16-15-19-8-2-5-11-23(19)25/h3,6,9,12,18-19,21-23,25H,1-2,4-5,7-8,10-11,13-17H2/t18-,19-,21?,22?,23?,25?/m0/s1 |
| InChIKey | XZZYZNCHVVLXCX-PXZJSKCZSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |