C15H19I — CID 139448646
2-iodotricyclo[9.4.0.03,8]pentadeca-1(15),11,13-triene (PubChem CID 139448646) has the molecular formula C15H19I and a molecular weight of 326.22 g/mol. Its IUPAC name is 2-iodotricyclo[9.4.0.03,8]pentadeca-1(15),11,13-triene.
| Compound Name | 2-iodotricyclo[9.4.0.03,8]pentadeca-1(15),11,13-triene |
|---|---|
| PubChem CID | 139448646 |
| Molecular Formula | C15H19I |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-iodotricyclo[9.4.0.03,8]pentadeca-1(15),11,13-triene |
| SMILES | IC1c2ccccc2CCC2CCCCC21 |
| InChI | InChI=1S/C15H19I/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1,3,5,7,12,14-15H,2,4,6,8-10H2 |
| InChIKey | LAVWEFVYSOIAAF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|