C12H14AlCl — CID 135083025
(3aS,9bS)-2-chloro-1,3,3a,4,5,9b-hexahydrobenzo[e][2]benzalumole (PubChem CID 135083025) has the molecular formula C12H14AlCl and a molecular weight of 220.68 g/mol. Its IUPAC name is (3aS,9bS)-2-chloro-1,3,3a,4,5,9b-hexahydrobenzo[e][2]benzalumole.
| Compound Name | (3aS,9bS)-2-chloro-1,3,3a,4,5,9b-hexahydrobenzo[e][2]benzalumole |
|---|---|
| PubChem CID | 135083025 |
| Molecular Formula | C12H14AlCl |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | (3aS,9bS)-2-chloro-1,3,3a,4,5,9b-hexahydrobenzo[e][2]benzalumole |
| SMILES | Cl[Al]1C[C@H]2CCc3ccccc3[C@H]2C1 |
| InChI | InChI=1S/C12H14.Al.ClH/c1-9-7-8-11-5-3-4-6-12(11)10(9)2;;/h3-6,9-10H,1-2,7-8H2;;1H/q;+1;/p-1/t9-,10-;;/m0../s1 |
| InChIKey | GBFIWWUVSQAAMH-BZDVOYDHSA-M |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |