C14H16O — CID 141032918
(4aS,10aS)-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-one (PubChem CID 141032918) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is (4aS,10aS)-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-one.
| Compound Name | (4aS,10aS)-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-one |
|---|---|
| PubChem CID | 141032918 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (4aS,10aS)-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-one |
| SMILES | O=C1CC[C@@H]2c3ccccc3CC[C@H]2C1 |
| InChI | InChI=1S/C14H16O/c15-12-7-8-14-11(9-12)6-5-10-3-1-2-4-13(10)14/h1-4,11,14H,5-9H2/t11-,14-/m0/s1 |
| InChIKey | LHLRFTACPSHIIN-FZMZJTMJSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |