C18H22O — CID 89471715
5,6a,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-6-one (PubChem CID 89471715) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is 5,6a,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-6-one.
| Compound Name | 5,6a,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-6-one |
|---|---|
| PubChem CID | 89471715 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 5,6a,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-6-one |
| SMILES | O=C1CC2c3ccccc3CCC2C2CCCCC12 |
| InChI | InChI=1S/C18H22O/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-2,5-6,14-17H,3-4,7-11H2 |
| InChIKey | OEPCRJDOKZORCJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |