C26H48 — CID 90721332
ethane;6-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene (PubChem CID 90721332) has the molecular formula C26H48 and a molecular weight of 360.67 g/mol. Its IUPAC name is ethane;6-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene.
| Compound Name | ethane;6-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 90721332 |
| Molecular Formula | C26H48 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 360.38 |
| IUPAC Name | ethane;6-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene |
| SMILES | CC.CC.CC.CC.CC1CC2C(CCC3CCCC32)c2ccccc21 |
| InChI | InChI=1S/C18H24.4C2H6/c1-12-11-18-15-8-4-5-13(15)9-10-17(18)16-7-3-2-6-14(12)16;4*1-2/h2-3,6-7,12-13,15,17-18H,4-5,8-11H2,1H3;4*1-2H3 |
| InChIKey | PVGQWHOUWUXAMS-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |