C16H20O3 — CID 11265436
(1S,2R,5S,6R)-2-cyclohexyl-5-phenyl-3,4,7-trioxabicyclo[4.1.0]heptane (PubChem CID 11265436) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (1S,2R,5S,6R)-2-cyclohexyl-5-phenyl-3,4,7-trioxabicyclo[4.1.0]heptane.
| Compound Name | (1S,2R,5S,6R)-2-cyclohexyl-5-phenyl-3,4,7-trioxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 11265436 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (1S,2R,5S,6R)-2-cyclohexyl-5-phenyl-3,4,7-trioxabicyclo[4.1.0]heptane |
| SMILES | c1ccc([C@@H]2OO[C@H](C3CCCCC3)[C@H]3O[C@H]32)cc1 |
| InChI | InChI=1S/C16H20O3/c1-3-7-11(8-4-1)13-15-16(17-15)14(19-18-13)12-9-5-2-6-10-12/h1,3-4,7-8,12-16H,2,5-6,9-10H2/t13-,14+,15-,16+/m0/s1 |
| InChIKey | NRIWVEOBKDHIOV-XUWVNRHRSA-N |
| XLogP | 3.41 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|