C16H22O — CID 100996137
(2R,3S,4S)-2-cyclohexyl-3-methyl-4-phenyloxetane (PubChem CID 100996137) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (2R,3S,4S)-2-cyclohexyl-3-methyl-4-phenyloxetane.
| Compound Name | (2R,3S,4S)-2-cyclohexyl-3-methyl-4-phenyloxetane |
|---|---|
| PubChem CID | 100996137 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2R,3S,4S)-2-cyclohexyl-3-methyl-4-phenyloxetane |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)O[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C16H22O/c1-12-15(13-8-4-2-5-9-13)17-16(12)14-10-6-3-7-11-14/h2,4-5,8-9,12,14-16H,3,6-7,10-11H2,1H3/t12-,15+,16+/m1/s1 |
| InChIKey | ZZSIZECDUYLQPS-KCXAZCMYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |