C15H21NO — CID 135070526
3-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydro-[1,3]oxazolo[3,2-a]azepine (PubChem CID 135070526) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydro-[1,3]oxazolo[3,2-a]azepine.
| Compound Name | 3-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydro-[1,3]oxazolo[3,2-a]azepine |
|---|---|
| PubChem CID | 135070526 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 3-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydro-[1,3]oxazolo[3,2-a]azepine |
| SMILES | CC1C(c2ccccc2)OC2CCCCCN21 |
| InChI | InChI=1S/C15H21NO/c1-12-15(13-8-4-2-5-9-13)17-14-10-6-3-7-11-16(12)14/h2,4-5,8-9,12,14-15H,3,6-7,10-11H2,1H3 |
| InChIKey | LSZCSKMUNLNJBK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |