C13H18O2 — CID 132539210
(2S,4S,5R,6S)-2,4,5-trimethyl-6-phenyl-1,3-dioxane (PubChem CID 132539210) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is (2S,4S,5R,6S)-2,4,5-trimethyl-6-phenyl-1,3-dioxane.
| Compound Name | (2S,4S,5R,6S)-2,4,5-trimethyl-6-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 132539210 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (2S,4S,5R,6S)-2,4,5-trimethyl-6-phenyl-1,3-dioxane |
| SMILES | C[C@H]1O[C@@H](C)[C@@H](C)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C13H18O2/c1-9-10(2)14-11(3)15-13(9)12-7-5-4-6-8-12/h4-11,13H,1-3H3/t9-,10+,11+,13+/m1/s1 |
| InChIKey | IYBKPQUETSHXEG-BLFANLJRSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |