C16H23N — CID 70595398
(3R)-1-methyl-3-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline (PubChem CID 70595398) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (3R)-1-methyl-3-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline.
| Compound Name | (3R)-1-methyl-3-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
|---|---|
| PubChem CID | 70595398 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (3R)-1-methyl-3-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
| SMILES | CC1N[C@@H](c2ccccc2)CC2CCCCC21 |
| InChI | InChI=1S/C16H23N/c1-12-15-10-6-5-9-14(15)11-16(17-12)13-7-3-2-4-8-13/h2-4,7-8,12,14-17H,5-6,9-11H2,1H3/t12?,14?,15?,16-/m1/s1 |
| InChIKey | NMEZCDYMXRNUDZ-GFNQVQDPSA-N |
| XLogP | 3.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |