C21H26N2 — CID 69477253
(4R,5R)-2-cyclohexyl-4,5-diphenylimidazolidine (PubChem CID 69477253) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (4R,5R)-2-cyclohexyl-4,5-diphenylimidazolidine.
| Compound Name | (4R,5R)-2-cyclohexyl-4,5-diphenylimidazolidine |
|---|---|
| PubChem CID | 69477253 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (4R,5R)-2-cyclohexyl-4,5-diphenylimidazolidine |
| SMILES | c1ccc([C@H]2NC(C3CCCCC3)N[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)23-21(22-19)18-14-8-3-9-15-18/h1-2,4-7,10-13,18-23H,3,8-9,14-15H2/t19-,20-/m1/s1 |
| InChIKey | CIIHZUZHYWRJBU-WOJBJXKFSA-N |
| XLogP | 4.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |