C14H19N — CID 167142843
2-phenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-amine (PubChem CID 167142843) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-phenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-amine.
| Compound Name | 2-phenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-amine |
|---|---|
| PubChem CID | 167142843 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-phenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-amine |
| SMILES | NC1C(c2ccccc2)CC2CCCC21 |
| InChI | InChI=1S/C14H19N/c15-14-12-8-4-7-11(12)9-13(14)10-5-2-1-3-6-10/h1-3,5-6,11-14H,4,7-9,15H2 |
| InChIKey | ANKOTCMFOIYDTN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |