C15H21N — CID 67618847
(7aS)-2-methyl-4-phenyl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 67618847) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (7aS)-2-methyl-4-phenyl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (7aS)-2-methyl-4-phenyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 67618847 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (7aS)-2-methyl-4-phenyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CN1CC2C(c3ccccc3)CCC[C@@H]2C1 |
| InChI | InChI=1S/C15H21N/c1-16-10-13-8-5-9-14(15(13)11-16)12-6-3-2-4-7-12/h2-4,6-7,13-15H,5,8-11H2,1H3/t13-,14?,15?/m1/s1 |
| InChIKey | SOCFCCJDXGBETO-WLYUNCDWSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |