C17H24O — CID 134902369
cis-(2R,4S)-4-cyclohexyl-1-deuterio-2-phenylcyclopentan-1-ol (PubChem CID 134902369) has the molecular formula C17H24O and a molecular weight of 245.38 g/mol. Its IUPAC name is cis-(2R,4S)-4-cyclohexyl-1-deuterio-2-phenylcyclopentan-1-ol.
| Compound Name | cis-(2R,4S)-4-cyclohexyl-1-deuterio-2-phenylcyclopentan-1-ol |
|---|---|
| PubChem CID | 134902369 |
| Molecular Formula | C17H24O |
| Molecular Weight | 245.38 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | cis-(2R,4S)-4-cyclohexyl-1-deuterio-2-phenylcyclopentan-1-ol |
| SMILES | [2H]C1(O)C[C@@H](C2CCCCC2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H24O/c18-17-12-15(13-7-3-1-4-8-13)11-16(17)14-9-5-2-6-10-14/h2,5-6,9-10,13,15-18H,1,3-4,7-8,11-12H2/t15-,16+,17?/m0/s1/i17D |
| InChIKey | OHXFIZILAZDZDK-POZRFRIDSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |