C15H22SSi — CID 101346356
trimethyl-[[(2S,4S)-4-phenyl-3,4-dihydro-2H-thiopyran-2-yl]methyl]silane (PubChem CID 101346356) has the molecular formula C15H22SSi and a molecular weight of 262.49 g/mol. Its IUPAC name is trimethyl-[[(2S,4S)-4-phenyl-3,4-dihydro-2H-thiopyran-2-yl]methyl]silane.
| Compound Name | trimethyl-[[(2S,4S)-4-phenyl-3,4-dihydro-2H-thiopyran-2-yl]methyl]silane |
|---|---|
| PubChem CID | 101346356 |
| Molecular Formula | C15H22SSi |
| Molecular Weight | 262.49 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | trimethyl-[[(2S,4S)-4-phenyl-3,4-dihydro-2H-thiopyran-2-yl]methyl]silane |
| SMILES | C[Si](C)(C)C[C@@H]1C[C@H](c2ccccc2)C=CS1 |
| InChI | InChI=1S/C15H22SSi/c1-17(2,3)12-15-11-14(9-10-16-15)13-7-5-4-6-8-13/h4-10,14-15H,11-12H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | FCFSTUUHEUERMT-CABCVRRESA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|