C20H31NO2Si — CID 11772351
(4S,6S,8S,8aS)-4-phenyl-6-propan-2-yl-8-(trimethylsilylmethyl)-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one (PubChem CID 11772351) has the molecular formula C20H31NO2Si and a molecular weight of 345.56 g/mol. Its IUPAC name is (4S,6S,8S,8aS)-4-phenyl-6-propan-2-yl-8-(trimethylsilylmethyl)-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one.
| Compound Name | (4S,6S,8S,8aS)-4-phenyl-6-propan-2-yl-8-(trimethylsilylmethyl)-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 11772351 |
| Molecular Formula | C20H31NO2Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (4S,6S,8S,8aS)-4-phenyl-6-propan-2-yl-8-(trimethylsilylmethyl)-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
| SMILES | CC(C)[C@@H]1C[C@H](C[Si](C)(C)C)[C@H]2C(=O)OC[C@H](c3ccccc3)N21 |
| InChI | InChI=1S/C20H31NO2Si/c1-14(2)17-11-16(13-24(3,4)5)19-20(22)23-12-18(21(17)19)15-9-7-6-8-10-15/h6-10,14,16-19H,11-13H2,1-5H3/t16-,17+,18-,19+/m1/s1 |
| InChIKey | VGYMKCRMFFEZKK-HCXYKTFWSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|