C14H20N2 — CID 57172412
2,2-diethyl-5-phenyl-5,6-dihydro-1H-pyrimidine (PubChem CID 57172412) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,2-diethyl-5-phenyl-5,6-dihydro-1H-pyrimidine.
| Compound Name | 2,2-diethyl-5-phenyl-5,6-dihydro-1H-pyrimidine |
|---|---|
| PubChem CID | 57172412 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2,2-diethyl-5-phenyl-5,6-dihydro-1H-pyrimidine |
| SMILES | CCC1(CC)N=CC(c2ccccc2)CN1 |
| InChI | InChI=1S/C14H20N2/c1-3-14(4-2)15-10-13(11-16-14)12-8-6-5-7-9-12/h5-10,13,16H,3-4,11H2,1-2H3 |
| InChIKey | SKVXKKICILXTFX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |