C17H21PSi — CID 101109188
[(2S,3R)-2,3-diphenylphosphiran-1-yl]-trimethylsilane (PubChem CID 101109188) has the molecular formula C17H21PSi and a molecular weight of 284.42 g/mol. Its IUPAC name is [(2S,3R)-2,3-diphenylphosphiran-1-yl]-trimethylsilane.
| Compound Name | [(2S,3R)-2,3-diphenylphosphiran-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101109188 |
| Molecular Formula | C17H21PSi |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [(2S,3R)-2,3-diphenylphosphiran-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)P1[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H21PSi/c1-19(2,3)18-16(14-10-6-4-7-11-14)17(18)15-12-8-5-9-13-15/h4-13,16-17H,1-3H3/t16-,17+,18? |
| InChIKey | KCQWMHSRVOBKNZ-JWTNVVGKSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|