About 3-phenyl-3H-diazirine
3-phenyl-3H-diazirine (PubChem CID 10855430) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 3-phenyl-3H-diazirine.
Molecular Properties
| Compound Name | 3-phenyl-3H-diazirine |
| PubChem CID | 10855430 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 3-phenyl-3H-diazirine |
| SMILES | c1ccc(C2N=N2)cc1 |
| InChI | InChI=1S/C7H6N2/c1-2-4-6(5-3-1)7-8-9-7/h1-5,7H |
| InChIKey | DCXIMRSHMXAVHX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-3H-diazirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-3H-diazirine?
The IUPAC name of 3-phenyl-3H-diazirine (CID 10855430) is 3-phenyl-3H-diazirine.
What is the SMILES notation for 3-phenyl-3H-diazirine?
The canonical SMILES for 3-phenyl-3H-diazirine is c1ccc(C2N=N2)cc1.
What is the InChIKey of 3-phenyl-3H-diazirine?
The InChIKey is DCXIMRSHMXAVHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c1-2-4-6(5-3-1)7-8-9-7/h1-5,7H.
What are the key properties of 3-phenyl-3H-diazirine?
3-phenyl-3H-diazirine has a molecular weight of 118.14 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-3H-diazirine is sourced from PubChem (CID 10855430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).