C15H14N2 — CID 12616610
3,5-diphenyl-4,5-dihydro-3H-pyrazole (PubChem CID 12616610) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3,5-diphenyl-4,5-dihydro-3H-pyrazole.
| Compound Name | 3,5-diphenyl-4,5-dihydro-3H-pyrazole |
|---|---|
| PubChem CID | 12616610 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3,5-diphenyl-4,5-dihydro-3H-pyrazole |
| SMILES | c1ccc(C2CC(c3ccccc3)N=N2)cc1 |
| InChI | InChI=1S/C15H14N2/c1-3-7-12(8-4-1)14-11-15(17-16-14)13-9-5-2-6-10-13/h1-10,14-15H,11H2 |
| InChIKey | OXKMXFFCZFWVQJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |