C10H12N2O — CID 13432426
4-phenyl-1,4,5,6-tetrahydropyrimidin-6-ol (PubChem CID 13432426) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-phenyl-1,4,5,6-tetrahydropyrimidin-6-ol.
| Compound Name | 4-phenyl-1,4,5,6-tetrahydropyrimidin-6-ol |
|---|---|
| PubChem CID | 13432426 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-phenyl-1,4,5,6-tetrahydropyrimidin-6-ol |
| SMILES | OC1CC(c2ccccc2)N=CN1 |
| InChI | InChI=1S/C10H12N2O/c13-10-6-9(11-7-12-10)8-4-2-1-3-5-8/h1-5,7,9-10,13H,6H2,(H,11,12) |
| InChIKey | LCJWASQGBPJOLY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |