C17H18N2O — CID 175247388
4-phenyl-5-(phenylmethoxymethyl)-4,5-dihydro-1H-imidazole (PubChem CID 175247388) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-phenyl-5-(phenylmethoxymethyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 4-phenyl-5-(phenylmethoxymethyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 175247388 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-phenyl-5-(phenylmethoxymethyl)-4,5-dihydro-1H-imidazole |
| SMILES | C1=NC(c2ccccc2)C(COCc2ccccc2)N1 |
| InChI | InChI=1S/C17H18N2O/c1-3-7-14(8-4-1)11-20-12-16-17(19-13-18-16)15-9-5-2-6-10-15/h1-10,13,16-17H,11-12H2,(H,18,19) |
| InChIKey | ABBMEHPOGXRUTJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |