C11H13NO2 — CID 152778467
4-(phenylmethoxymethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 152778467) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-(phenylmethoxymethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(phenylmethoxymethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 152778467 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-(phenylmethoxymethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | C1=NC(COCc2ccccc2)CO1 |
| InChI | InChI=1S/C11H13NO2/c1-2-4-10(5-3-1)6-13-7-11-8-14-9-12-11/h1-5,9,11H,6-8H2 |
| InChIKey | JAWVIGQSVIIPLZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |