C36H41NO4 — CID 11215002
(2S,3S,4R,5R,6S)-2-ethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine (PubChem CID 11215002) has the molecular formula C36H41NO4 and a molecular weight of 551.73 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-ethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine.
| Compound Name | (2S,3S,4R,5R,6S)-2-ethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 11215002 |
| Molecular Formula | C36H41NO4 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-ethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine |
| SMILES | CC[C@@H]1N[C@@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H41NO4/c1-2-32-34(39-24-29-17-9-4-10-18-29)36(41-26-31-21-13-6-14-22-31)35(40-25-30-19-11-5-12-20-30)33(37-32)27-38-23-28-15-7-3-8-16-28/h3-22,32-37H,2,23-27H2,1H3/t32-,33-,34-,35+,36+/m0/s1 |
| InChIKey | RNZFVCSBTAMVBY-YQYWCZHNSA-N |
| XLogP | 6.71 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |