C35H38N2O5 — CID 71484738
(2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-carboxamide (PubChem CID 71484738) has the molecular formula C35H38N2O5 and a molecular weight of 566.70 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-carboxamide.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 71484738 |
| Molecular Formula | C35H38N2O5 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1N[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H38N2O5/c36-35(38)31-33(41-23-28-17-9-3-10-18-28)34(42-24-29-19-11-4-12-20-29)32(40-22-27-15-7-2-8-16-27)30(37-31)25-39-21-26-13-5-1-6-14-26/h1-20,30-34,37H,21-25H2,(H2,36,38)/t30-,31+,32-,33+,34+/m1/s1 |
| InChIKey | MZGNWNUXIMMUEI-BBZHULIZSA-N |
| XLogP | 4.79 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |