C32H31F2NO4 — CID 71480522
2-[(2R,3R,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]-4,5-difluorophenol (PubChem CID 71480522) has the molecular formula C32H31F2NO4 and a molecular weight of 531.60 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]-4,5-difluorophenol.
| Compound Name | 2-[(2R,3R,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]-4,5-difluorophenol |
|---|---|
| PubChem CID | 71480522 |
| Molecular Formula | C32H31F2NO4 |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-[(2R,3R,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]-4,5-difluorophenol |
| SMILES | Oc1cc(F)c(F)cc1[C@H]1N[C@@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H31F2NO4/c33-26-16-25(29(36)17-27(26)34)30-32(39-20-24-14-8-3-9-15-24)31(38-19-23-12-6-2-7-13-23)28(35-30)21-37-18-22-10-4-1-5-11-22/h1-17,28,30-32,35-36H,18-21H2/t28-,30+,31+,32+/m0/s1 |
| InChIKey | GRUDDFDKKLPIQP-NLSYYIHOSA-N |
| XLogP | 6.07 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|