C9H9N3 — CID 10678525
4-phenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 10678525) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 4-phenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-phenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 10678525 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 4-phenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=NC(c2ccccc2)N=CN1 |
| InChI | InChI=1S/C9H9N3/c1-2-4-8(5-3-1)9-11-6-10-7-12-9/h1-7,9H,(H,10,11,12) |
| InChIKey | HNKGKLYVCXSLBO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |