C23H20S — CID 101223989
(2S,4R)-2,4,6-triphenyl-3,4-dihydro-2H-thiopyran (PubChem CID 101223989) has the molecular formula C23H20S and a molecular weight of 328.48 g/mol. Its IUPAC name is (2S,4R)-2,4,6-triphenyl-3,4-dihydro-2H-thiopyran.
| Compound Name | (2S,4R)-2,4,6-triphenyl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 101223989 |
| Molecular Formula | C23H20S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2S,4R)-2,4,6-triphenyl-3,4-dihydro-2H-thiopyran |
| SMILES | C1=C(c2ccccc2)S[C@H](c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H20S/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20/h1-16,21,23H,17H2/t21-,23-/m0/s1 |
| InChIKey | GNVISYFELGPVLX-GMAHTHKFSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |