C18H19ClN4O2S — CID 59339487
N-(3-chlorophenyl)sulfonyl-N'-ethyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 59339487) has the molecular formula C18H19ClN4O2S and a molecular weight of 390.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)sulfonyl-N'-ethyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-(3-chlorophenyl)sulfonyl-N'-ethyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 59339487 |
| Molecular Formula | C18H19ClN4O2S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-(3-chlorophenyl)sulfonyl-N'-ethyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1cccc(Cl)c1)N1CC(c2ccccc2)C=N1 |
| InChI | InChI=1S/C18H19ClN4O2S/c1-2-20-18(22-26(24,25)17-10-6-9-16(19)11-17)23-13-15(12-21-23)14-7-4-3-5-8-14/h3-12,15H,2,13H2,1H3,(H,20,22) |
| InChIKey | FOFJSNMSAYPFCM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|