C16H17ClN4O3S — CID 59339353
N-(3-chlorophenyl)sulfonyl-N'-ethyl-3-(furan-3-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 59339353) has the molecular formula C16H17ClN4O3S and a molecular weight of 380.86 g/mol. Its IUPAC name is N-(3-chlorophenyl)sulfonyl-N'-ethyl-3-(furan-3-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-(3-chlorophenyl)sulfonyl-N'-ethyl-3-(furan-3-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 59339353 |
| Molecular Formula | C16H17ClN4O3S |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-(3-chlorophenyl)sulfonyl-N'-ethyl-3-(furan-3-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC/N=C(\NS(=O)(=O)c1cccc(Cl)c1)N1N=CCC1c1ccoc1 |
| InChI | InChI=1S/C16H17ClN4O3S/c1-2-18-16(20-25(22,23)14-5-3-4-13(17)10-14)21-15(6-8-19-21)12-7-9-24-11-12/h3-5,7-11,15H,2,6H2,1H3,(H,18,20) |
| InChIKey | USHSNDFZDLVKJU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|