C24H22Cl2N4O3S — CID 11569861
5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-ethyl-4-hydroxy-4-phenyl-3H-pyrazole-2-carboximidamide (PubChem CID 11569861) has the molecular formula C24H22Cl2N4O3S and a molecular weight of 517.44 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-ethyl-4-hydroxy-4-phenyl-3H-pyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-ethyl-4-hydroxy-4-phenyl-3H-pyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 11569861 |
| Molecular Formula | C24H22Cl2N4O3S |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-ethyl-4-hydroxy-4-phenyl-3H-pyrazole-2-carboximidamide |
| SMILES | CC/N=C(\NS(=O)(=O)c1ccc(Cl)cc1)N1CC(O)(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C24H22Cl2N4O3S/c1-2-27-23(29-34(32,33)21-14-12-20(26)13-15-21)30-16-24(31,18-6-4-3-5-7-18)22(28-30)17-8-10-19(25)11-9-17/h3-15,31H,2,16H2,1H3,(H,27,29) |
| InChIKey | YSOLAZQGLFVSLS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|