C32H29ClN4O6S — CID 25177040
ethyl 2-[[4-[2-[(E)-N'-(4-chlorophenyl)sulfonylcarbamimidoyl]-4-hydroxy-4-phenyl-3H-pyrazol-5-yl]phenoxy]methyl]benzoate (PubChem CID 25177040) has the molecular formula C32H29ClN4O6S and a molecular weight of 633.13 g/mol. Its IUPAC name is ethyl 2-[[4-[2-[(E)-N'-(4-chlorophenyl)sulfonylcarbamimidoyl]-4-hydroxy-4-phenyl-3H-pyrazol-5-yl]phenoxy]methyl]benzoate.
| Compound Name | ethyl 2-[[4-[2-[(E)-N'-(4-chlorophenyl)sulfonylcarbamimidoyl]-4-hydroxy-4-phenyl-3H-pyrazol-5-yl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 25177040 |
| Molecular Formula | C32H29ClN4O6S |
| Molecular Weight | 633.13 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | ethyl 2-[[4-[2-[(E)-N'-(4-chlorophenyl)sulfonylcarbamimidoyl]-4-hydroxy-4-phenyl-3H-pyrazol-5-yl]phenoxy]methyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1COc1ccc(C2=NN(/C(N)=N/S(=O)(=O)c3ccc(Cl)cc3)CC2(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H29ClN4O6S/c1-2-42-30(38)28-11-7-6-8-23(28)20-43-26-16-12-22(13-17-26)29-32(39,24-9-4-3-5-10-24)21-37(35-29)31(34)36-44(40,41)27-18-14-25(33)15-19-27/h3-19,39H,2,20-21H2,1H3,(H2,34,36) |
| InChIKey | HHWPUARDUPKPAL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.13 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|