C24H32N6O2S — CID 58158681
8-benzyl-N'-ethyl-N-[4-(methylamino)phenyl]sulfonyl-2,3,8-triazaspiro[4.5]dec-3-ene-2-carboximidamide (PubChem CID 58158681) has the molecular formula C24H32N6O2S and a molecular weight of 468.63 g/mol. Its IUPAC name is 8-benzyl-N'-ethyl-N-[4-(methylamino)phenyl]sulfonyl-2,3,8-triazaspiro[4.5]dec-3-ene-2-carboximidamide.
| Compound Name | 8-benzyl-N'-ethyl-N-[4-(methylamino)phenyl]sulfonyl-2,3,8-triazaspiro[4.5]dec-3-ene-2-carboximidamide |
|---|---|
| PubChem CID | 58158681 |
| Molecular Formula | C24H32N6O2S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 8-benzyl-N'-ethyl-N-[4-(methylamino)phenyl]sulfonyl-2,3,8-triazaspiro[4.5]dec-3-ene-2-carboximidamide |
| SMILES | CC/N=C(\NS(=O)(=O)c1ccc(NC)cc1)N1CC2(C=N1)CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C24H32N6O2S/c1-3-26-23(28-33(31,32)22-11-9-21(25-2)10-12-22)30-19-24(18-27-30)13-15-29(16-14-24)17-20-7-5-4-6-8-20/h4-12,18,25H,3,13-17,19H2,1-2H3,(H,26,28) |
| InChIKey | GHLYBBAUKGPKNN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|