C21H32N6O4S — CID 66933465
tert-butyl N-[4-[[N-ethyl-C-(2,3,8-triazaspiro[4.5]dec-3-en-2-yl)carbonimidoyl]sulfamoyl]phenyl]carbamate (PubChem CID 66933465) has the molecular formula C21H32N6O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is tert-butyl N-[4-[[N-ethyl-C-(2,3,8-triazaspiro[4.5]dec-3-en-2-yl)carbonimidoyl]sulfamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[N-ethyl-C-(2,3,8-triazaspiro[4.5]dec-3-en-2-yl)carbonimidoyl]sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 66933465 |
| Molecular Formula | C21H32N6O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | tert-butyl N-[4-[[N-ethyl-C-(2,3,8-triazaspiro[4.5]dec-3-en-2-yl)carbonimidoyl]sulfamoyl]phenyl]carbamate |
| SMILES | CC/N=C(\NS(=O)(=O)c1ccc(NC(=O)OC(C)(C)C)cc1)N1CC2(C=N1)CCNCC2 |
| InChI | InChI=1S/C21H32N6O4S/c1-5-23-18(27-15-21(14-24-27)10-12-22-13-11-21)26-32(29,30)17-8-6-16(7-9-17)25-19(28)31-20(2,3)4/h6-9,14,22H,5,10-13,15H2,1-4H3,(H,23,26)(H,25,28) |
| InChIKey | HBTIENAYHFSTLU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|