C25H25Cl2N5O4S2 — CID 170164544
(4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-(2-sulfamoylpropyl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 170164544) has the molecular formula C25H25Cl2N5O4S2 and a molecular weight of 594.55 g/mol. Its IUPAC name is (4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-(2-sulfamoylpropyl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-(2-sulfamoylpropyl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 170164544 |
| Molecular Formula | C25H25Cl2N5O4S2 |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | (4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-(2-sulfamoylpropyl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC(C/N=C(/NS(=O)(=O)c1ccc(Cl)cc1)N1C[C@@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1)S(N)(=O)=O |
| InChI | InChI=1S/C25H25Cl2N5O4S2/c1-17(37(28,33)34)15-29-25(31-38(35,36)22-13-11-21(27)12-14-22)32-16-23(18-5-3-2-4-6-18)24(30-32)19-7-9-20(26)10-8-19/h2-14,17,23H,15-16H2,1H3,(H,29,31)(H2,28,33,34)/t17?,23-/m0/s1 |
| InChIKey | URZADDBTBIDKPQ-VXLWULRPSA-N |
| XLogP | 3.81 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|