C26H25ClF3N5O4S2 — CID 169235370
(4R)-5-(4-chlorophenyl)-4-phenyl-N'-[(2S)-1-sulfamoylpropan-2-yl]-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 169235370) has the molecular formula C26H25ClF3N5O4S2 and a molecular weight of 628.10 g/mol. Its IUPAC name is (4R)-5-(4-chlorophenyl)-4-phenyl-N'-[(2S)-1-sulfamoylpropan-2-yl]-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4R)-5-(4-chlorophenyl)-4-phenyl-N'-[(2S)-1-sulfamoylpropan-2-yl]-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 169235370 |
| Molecular Formula | C26H25ClF3N5O4S2 |
| Molecular Weight | 628.10 g/mol |
| Exact Mass | 627.10 |
| IUPAC Name | (4R)-5-(4-chlorophenyl)-4-phenyl-N'-[(2S)-1-sulfamoylpropan-2-yl]-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | C[C@@H](CS(N)(=O)=O)/N=C(/NS(=O)(=O)c1ccc(C(F)(F)F)cc1)N1C[C@@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C26H25ClF3N5O4S2/c1-17(16-40(31,36)37)32-25(34-41(38,39)22-13-9-20(10-14-22)26(28,29)30)35-15-23(18-5-3-2-4-6-18)24(33-35)19-7-11-21(27)12-8-19/h2-14,17,23H,15-16H2,1H3,(H,32,34)(H2,31,36,37)/t17-,23-/m0/s1 |
| InChIKey | DRYFEULRDOVVMA-SBUREZEXSA-N |
| XLogP | 4.17 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.10 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|