C27H26Cl2N6O4S2 — CID 169235200
(4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-[3-(sulfamoyliminomethyl)cyclobutyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 169235200) has the molecular formula C27H26Cl2N6O4S2 and a molecular weight of 633.58 g/mol. Its IUPAC name is (4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-[3-(sulfamoyliminomethyl)cyclobutyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-[3-(sulfamoyliminomethyl)cyclobutyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 169235200 |
| Molecular Formula | C27H26Cl2N6O4S2 |
| Molecular Weight | 633.58 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | (4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-[3-(sulfamoyliminomethyl)cyclobutyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | NS(=O)(=O)N=CC1CC(/N=C(/NS(=O)(=O)c2ccc(Cl)cc2)N2C[C@@H](c3ccccc3)C(c3ccc(Cl)cc3)=N2)C1 |
| InChI | InChI=1S/C27H26Cl2N6O4S2/c28-21-8-6-20(7-9-21)26-25(19-4-2-1-3-5-19)17-35(33-26)27(32-23-14-18(15-23)16-31-41(30,38)39)34-40(36,37)24-12-10-22(29)11-13-24/h1-13,16,18,23,25H,14-15,17H2,(H,32,34)(H2,30,38,39)/t18?,23?,25-/m0/s1 |
| InChIKey | QQGHYASOYBBNAH-GRNMKTRDSA-N |
| XLogP | 4.18 |
| TPSA | 146.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|