C26H26Cl2N6O4S2 — CID 169235690
(4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-[3-(sulfamoylamino)cyclobutyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 169235690) has the molecular formula C26H26Cl2N6O4S2 and a molecular weight of 621.57 g/mol. Its IUPAC name is (4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-[3-(sulfamoylamino)cyclobutyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-[3-(sulfamoylamino)cyclobutyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 169235690 |
| Molecular Formula | C26H26Cl2N6O4S2 |
| Molecular Weight | 621.57 g/mol |
| Exact Mass | 620.08 |
| IUPAC Name | (4R)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-4-phenyl-N'-[3-(sulfamoylamino)cyclobutyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | NS(=O)(=O)NC1CC(/N=C(/NS(=O)(=O)c2ccc(Cl)cc2)N2C[C@@H](c3ccccc3)C(c3ccc(Cl)cc3)=N2)C1 |
| InChI | InChI=1S/C26H26Cl2N6O4S2/c27-19-8-6-18(7-9-19)25-24(17-4-2-1-3-5-17)16-34(31-25)26(30-21-14-22(15-21)32-40(29,37)38)33-39(35,36)23-12-10-20(28)11-13-23/h1-13,21-22,24,32H,14-16H2,(H,30,33)(H2,29,37,38)/t21?,22?,24-/m0/s1 |
| InChIKey | PHLBBNBRBHMEBH-IWAAJCSBSA-N |
| XLogP | 3.46 |
| TPSA | 146.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|