C25H25ClN6O5S2 — CID 169235494
4-[[C-[(4S)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-(2-sulfamoylethyl)carbonimidoyl]sulfamoyl]benzamide (PubChem CID 169235494) has the molecular formula C25H25ClN6O5S2 and a molecular weight of 589.10 g/mol. Its IUPAC name is 4-[[C-[(4S)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-(2-sulfamoylethyl)carbonimidoyl]sulfamoyl]benzamide.
| Compound Name | 4-[[C-[(4S)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-(2-sulfamoylethyl)carbonimidoyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 169235494 |
| Molecular Formula | C25H25ClN6O5S2 |
| Molecular Weight | 589.10 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | 4-[[C-[(4S)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-(2-sulfamoylethyl)carbonimidoyl]sulfamoyl]benzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N/C(=N/CCS(N)(=O)=O)N2C[C@H](c3ccccc3)C(c3ccc(Cl)cc3)=N2)cc1 |
| InChI | InChI=1S/C25H25ClN6O5S2/c26-20-10-6-18(7-11-20)23-22(17-4-2-1-3-5-17)16-32(30-23)25(29-14-15-38(28,34)35)31-39(36,37)21-12-8-19(9-13-21)24(27)33/h1-13,22H,14-16H2,(H2,27,33)(H,29,31)(H2,28,34,35)/t22-/m1/s1 |
| InChIKey | YICFFAJVZNHKBQ-JOCHJYFZSA-N |
| XLogP | 1.87 |
| TPSA | 177.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.10 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|