C24H23F2N5O4S2 — CID 169235186
(4S)-5-(4-fluorophenyl)-N-(4-fluorophenyl)sulfonyl-4-phenyl-N'-(2-sulfamoylethyl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 169235186) has the molecular formula C24H23F2N5O4S2 and a molecular weight of 547.61 g/mol. Its IUPAC name is (4S)-5-(4-fluorophenyl)-N-(4-fluorophenyl)sulfonyl-4-phenyl-N'-(2-sulfamoylethyl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4S)-5-(4-fluorophenyl)-N-(4-fluorophenyl)sulfonyl-4-phenyl-N'-(2-sulfamoylethyl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 169235186 |
| Molecular Formula | C24H23F2N5O4S2 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | (4S)-5-(4-fluorophenyl)-N-(4-fluorophenyl)sulfonyl-4-phenyl-N'-(2-sulfamoylethyl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | NS(=O)(=O)CC/N=C(/NS(=O)(=O)c1ccc(F)cc1)N1C[C@H](c2ccccc2)C(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C24H23F2N5O4S2/c25-19-8-6-18(7-9-19)23-22(17-4-2-1-3-5-17)16-31(29-23)24(28-14-15-36(27,32)33)30-37(34,35)21-12-10-20(26)11-13-21/h1-13,22H,14-16H2,(H,28,30)(H2,27,32,33)/t22-/m1/s1 |
| InChIKey | CGKYFEKGSIPMRZ-JOCHJYFZSA-N |
| XLogP | 2.39 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|