C27H30ClFN6O4S2 — CID 169235688
(4S)-N-(4-chlorophenyl)sulfonyl-5-(4-fluorophenyl)-N'-[(2S)-3-methyl-2-(sulfamoylamino)butyl]-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 169235688) has the molecular formula C27H30ClFN6O4S2 and a molecular weight of 621.16 g/mol. Its IUPAC name is (4S)-N-(4-chlorophenyl)sulfonyl-5-(4-fluorophenyl)-N'-[(2S)-3-methyl-2-(sulfamoylamino)butyl]-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4S)-N-(4-chlorophenyl)sulfonyl-5-(4-fluorophenyl)-N'-[(2S)-3-methyl-2-(sulfamoylamino)butyl]-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 169235688 |
| Molecular Formula | C27H30ClFN6O4S2 |
| Molecular Weight | 621.16 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | (4S)-N-(4-chlorophenyl)sulfonyl-5-(4-fluorophenyl)-N'-[(2S)-3-methyl-2-(sulfamoylamino)butyl]-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC(C)[C@@H](C/N=C(/NS(=O)(=O)c1ccc(Cl)cc1)N1C[C@H](c2ccccc2)C(c2ccc(F)cc2)=N1)NS(N)(=O)=O |
| InChI | InChI=1S/C27H30ClFN6O4S2/c1-18(2)25(33-41(30,38)39)16-31-27(34-40(36,37)23-14-10-21(28)11-15-23)35-17-24(19-6-4-3-5-7-19)26(32-35)20-8-12-22(29)13-9-20/h3-15,18,24-25,33H,16-17H2,1-2H3,(H,31,34)(H2,30,38,39)/t24-,25-/m1/s1 |
| InChIKey | UUDCXHXRYLPVBX-JWQCQUIFSA-N |
| XLogP | 3.43 |
| TPSA | 146.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|