C26H25ClN4O4S — CID 46834420
ethyl 2-[[[(4-chlorophenyl)sulfonylamino]-(4,5-diphenyl-3,4-dihydropyrazol-2-yl)methylidene]amino]acetate (PubChem CID 46834420) has the molecular formula C26H25ClN4O4S and a molecular weight of 525.03 g/mol. Its IUPAC name is ethyl 2-[[[(4-chlorophenyl)sulfonylamino]-(4,5-diphenyl-3,4-dihydropyrazol-2-yl)methylidene]amino]acetate.
| Compound Name | ethyl 2-[[[(4-chlorophenyl)sulfonylamino]-(4,5-diphenyl-3,4-dihydropyrazol-2-yl)methylidene]amino]acetate |
|---|---|
| PubChem CID | 46834420 |
| Molecular Formula | C26H25ClN4O4S |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | ethyl 2-[[[(4-chlorophenyl)sulfonylamino]-(4,5-diphenyl-3,4-dihydropyrazol-2-yl)methylidene]amino]acetate |
| SMILES | CCOC(=O)C/N=C(/NS(=O)(=O)c1ccc(Cl)cc1)N1CC(c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C26H25ClN4O4S/c1-2-35-24(32)17-28-26(30-36(33,34)22-15-13-21(27)14-16-22)31-18-23(19-9-5-3-6-10-19)25(29-31)20-11-7-4-8-12-20/h3-16,23H,2,17-18H2,1H3,(H,28,30) |
| InChIKey | JAKGJWYYEGUARM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|