C28H28ClN5O5S — CID 118136648
ethyl 3-[4-[2-[N-(4-chlorophenyl)sulfonyl-N'-methylcarbamimidoyl]-4-phenyl-3,4-dihydropyrazol-5-yl]anilino]-3-oxopropanoate (PubChem CID 118136648) has the molecular formula C28H28ClN5O5S and a molecular weight of 582.08 g/mol. Its IUPAC name is ethyl 3-[4-[2-[N-(4-chlorophenyl)sulfonyl-N'-methylcarbamimidoyl]-4-phenyl-3,4-dihydropyrazol-5-yl]anilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-[2-[N-(4-chlorophenyl)sulfonyl-N'-methylcarbamimidoyl]-4-phenyl-3,4-dihydropyrazol-5-yl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 118136648 |
| Molecular Formula | C28H28ClN5O5S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | ethyl 3-[4-[2-[N-(4-chlorophenyl)sulfonyl-N'-methylcarbamimidoyl]-4-phenyl-3,4-dihydropyrazol-5-yl]anilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1ccc(C2=NN(/C(=N\C)NS(=O)(=O)c3ccc(Cl)cc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28ClN5O5S/c1-3-39-26(36)17-25(35)31-22-13-9-20(10-14-22)27-24(19-7-5-4-6-8-19)18-34(32-27)28(30-2)33-40(37,38)23-15-11-21(29)12-16-23/h4-16,24H,3,17-18H2,1-2H3,(H,30,33)(H,31,35) |
| InChIKey | DVMMKCFRXMHCNO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|