C25H32ClN5O5S — CID 51354461
ethyl 2-[[C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl-ethylamino]-3-hydroxybutanoate (PubChem CID 51354461) has the molecular formula C25H32ClN5O5S and a molecular weight of 550.08 g/mol. Its IUPAC name is ethyl 2-[[C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl-ethylamino]-3-hydroxybutanoate.
| Compound Name | ethyl 2-[[C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl-ethylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 51354461 |
| Molecular Formula | C25H32ClN5O5S |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | ethyl 2-[[C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl-ethylamino]-3-hydroxybutanoate |
| SMILES | CCOC(=O)C(C(C)O)N(CC)S(=O)(=O)N/C(=N/C)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C25H32ClN5O5S/c1-5-31(23(17(3)32)24(33)36-6-2)37(34,35)29-25(27-4)30-16-21(18-10-8-7-9-11-18)22(28-30)19-12-14-20(26)15-13-19/h7-15,17,21,23,32H,5-6,16H2,1-4H3,(H,27,29) |
| InChIKey | VXMOAFWWZHSAOE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|