C18H21ClN6O2S — CID 22267346
5-(4-chlorophenyl)-N-(dimethylsulfamoyl)-N'-methyl-4-pyridin-3-yl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 22267346) has the molecular formula C18H21ClN6O2S and a molecular weight of 420.93 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(dimethylsulfamoyl)-N'-methyl-4-pyridin-3-yl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-(dimethylsulfamoyl)-N'-methyl-4-pyridin-3-yl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 22267346 |
| Molecular Formula | C18H21ClN6O2S |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(dimethylsulfamoyl)-N'-methyl-4-pyridin-3-yl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | C/N=C(\NS(=O)(=O)N(C)C)N1CC(c2cccnc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C18H21ClN6O2S/c1-20-18(23-28(26,27)24(2)3)25-12-16(14-5-4-10-21-11-14)17(22-25)13-6-8-15(19)9-7-13/h4-11,16H,12H2,1-3H3,(H,20,23) |
| InChIKey | KBEUTIGFLBNSFY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|