C23H20Cl2N4OS — CID 70248793
(4S)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfinyl-N'-methyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 70248793) has the molecular formula C23H20Cl2N4OS and a molecular weight of 471.41 g/mol. Its IUPAC name is (4S)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfinyl-N'-methyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4S)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfinyl-N'-methyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 70248793 |
| Molecular Formula | C23H20Cl2N4OS |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | (4S)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfinyl-N'-methyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | C/N=C(\NS(=O)c1ccc(Cl)cc1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H20Cl2N4OS/c1-26-23(28-31(30)20-13-11-19(25)12-14-20)29-15-21(16-5-3-2-4-6-16)22(27-29)17-7-9-18(24)10-8-17/h2-14,21H,15H2,1H3,(H,26,28)/t21-,31?/m1/s1 |
| InChIKey | GNMBSZPNJLMCLV-UBIBJYAGSA-N |
| XLogP | 5.10 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|